C14H33N3O — CID 103192144
3-[1-(dimethylamino)propan-2-yl-ethylamino]-2-methyl-2-(propylamino)propan-1-ol (PubChem CID 103192144) has the molecular formula C14H33N3O and a molecular weight of 259.44 g/mol. Its IUPAC name is 3-[1-(dimethylamino)propan-2-yl-ethylamino]-2-methyl-2-(propylamino)propan-1-ol.
| Compound Name | 3-[1-(dimethylamino)propan-2-yl-ethylamino]-2-methyl-2-(propylamino)propan-1-ol |
|---|---|
| PubChem CID | 103192144 |
| Molecular Formula | C14H33N3O |
| Molecular Weight | 259.44 g/mol |
| Exact Mass | 259.26 |
| IUPAC Name | 3-[1-(dimethylamino)propan-2-yl-ethylamino]-2-methyl-2-(propylamino)propan-1-ol |
| SMILES | CCCNC(C)(CO)CN(CC)C(C)CN(C)C |
| InChI | InChI=1S/C14H33N3O/c1-7-9-15-14(4,12-18)11-17(8-2)13(3)10-16(5)6/h13,15,18H,7-12H2,1-6H3 |
| InChIKey | BRTQYPRTNLMCMP-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 38.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.44 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |