C15H31NO5 — CID 104565270
ethyl 4-[2-(2-methoxyethoxy)ethoxy]-2-methyl-2-(propan-2-ylamino)butanoate (PubChem CID 104565270) has the molecular formula C15H31NO5 and a molecular weight of 305.42 g/mol. Its IUPAC name is ethyl 4-[2-(2-methoxyethoxy)ethoxy]-2-methyl-2-(propan-2-ylamino)butanoate.
| Compound Name | ethyl 4-[2-(2-methoxyethoxy)ethoxy]-2-methyl-2-(propan-2-ylamino)butanoate |
|---|---|
| PubChem CID | 104565270 |
| Molecular Formula | C15H31NO5 |
| Molecular Weight | 305.42 g/mol |
| Exact Mass | 305.22 |
| IUPAC Name | ethyl 4-[2-(2-methoxyethoxy)ethoxy]-2-methyl-2-(propan-2-ylamino)butanoate |
| SMILES | CCOC(=O)C(C)(CCOCCOCCOC)NC(C)C |
| InChI | InChI=1S/C15H31NO5/c1-6-21-14(17)15(4,16-13(2)3)7-8-19-11-12-20-10-9-18-5/h13,16H,6-12H2,1-5H3 |
| InChIKey | ZQUCCCFELUHRQD-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.42 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|