C13H27NO4 — CID 63685671
methyl 2-methyl-2-(propan-2-ylamino)-3-(2-propoxyethoxy)propanoate (PubChem CID 63685671) has the molecular formula C13H27NO4 and a molecular weight of 261.36 g/mol. Its IUPAC name is methyl 2-methyl-2-(propan-2-ylamino)-3-(2-propoxyethoxy)propanoate.
| Compound Name | methyl 2-methyl-2-(propan-2-ylamino)-3-(2-propoxyethoxy)propanoate |
|---|---|
| PubChem CID | 63685671 |
| Molecular Formula | C13H27NO4 |
| Molecular Weight | 261.36 g/mol |
| Exact Mass | 261.19 |
| IUPAC Name | methyl 2-methyl-2-(propan-2-ylamino)-3-(2-propoxyethoxy)propanoate |
| SMILES | CCCOCCOCC(C)(NC(C)C)C(=O)OC |
| InChI | InChI=1S/C13H27NO4/c1-6-7-17-8-9-18-10-13(4,12(15)16-5)14-11(2)3/h11,14H,6-10H2,1-5H3 |
| InChIKey | HGRSGPUIRPMPRQ-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.36 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|