C22H45N3O5 — CID 178049904
3-[2-[[3-oxo-3-(propylamino)propoxy]methyl]-2-(propan-2-ylamino)-3-propoxypropoxy]-N-propylpropanamide (PubChem CID 178049904) has the molecular formula C22H45N3O5 and a molecular weight of 431.62 g/mol. Its IUPAC name is 3-[2-[[3-oxo-3-(propylamino)propoxy]methyl]-2-(propan-2-ylamino)-3-propoxypropoxy]-N-propylpropanamide.
| Compound Name | 3-[2-[[3-oxo-3-(propylamino)propoxy]methyl]-2-(propan-2-ylamino)-3-propoxypropoxy]-N-propylpropanamide |
|---|---|
| PubChem CID | 178049904 |
| Molecular Formula | C22H45N3O5 |
| Molecular Weight | 431.62 g/mol |
| Exact Mass | 431.34 |
| IUPAC Name | 3-[2-[[3-oxo-3-(propylamino)propoxy]methyl]-2-(propan-2-ylamino)-3-propoxypropoxy]-N-propylpropanamide |
| SMILES | CCCNC(=O)CCOCC(COCCC)(COCCC(=O)NCCC)NC(C)C |
| InChI | InChI=1S/C22H45N3O5/c1-6-11-23-20(26)9-14-29-17-22(25-19(4)5,16-28-13-8-3)18-30-15-10-21(27)24-12-7-2/h19,25H,6-18H2,1-5H3,(H,23,26)(H,24,27) |
| InChIKey | AQXQEJJIDRESMP-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 97.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.62 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|