9-[(3S)-3,5-dihydroxy-6-methyloxan-2-yl]oxynonanoic acid

C15H28O6 — CID 144528411

IUPAC9-[(3S)-3,5-dihydroxy-6-methyloxan-2-yl]oxynonanoic acid
SMILESCC1OC(OCCCCCCCCC(=O)O)[C@@H](O)CC1O
InChIInChI=1S/C15H28O6/c1-11-12(16)10-13(17)15(21-11)20-9-7-5-3-2-4-6-8-14(18)19/h11-13,15-17H,2-10H2,1H3,(H,18,19)/t11?,12?,13-,15?/m0/s1
InChIKeyWGGIJTBDSYSSPD-WRSKWOSUSA-N
MW304.38 g/mol
LogP1.67
Rot. Bonds10

About 9-[(3S)-3,5-dihydroxy-6-methyloxan-2-yl]oxynonanoic acid

9-[(3S)-3,5-dihydroxy-6-methyloxan-2-yl]oxynonanoic acid (PubChem CID 144528411) has the molecular formula C15H28O6 and a molecular weight of 304.38 g/mol. Its IUPAC name is 9-[(3S)-3,5-dihydroxy-6-methyloxan-2-yl]oxynonanoic acid.

Molecular Properties

Compound Name9-[(3S)-3,5-dihydroxy-6-methyloxan-2-yl]oxynonanoic acid
PubChem CID144528411
Molecular FormulaC15H28O6
Molecular Weight304.38 g/mol
Exact Mass304.19
IUPAC Name9-[(3S)-3,5-dihydroxy-6-methyloxan-2-yl]oxynonanoic acid
SMILESCC1OC(OCCCCCCCCC(=O)O)[C@@H](O)CC1O
InChIInChI=1S/C15H28O6/c1-11-12(16)10-13(17)15(21-11)20-9-7-5-3-2-4-6-8-14(18)19/h11-13,15-17H,2-10H2,1H3,(H,18,19)/t11?,12?,13-,15?/m0/s1
InChIKeyWGGIJTBDSYSSPD-WRSKWOSUSA-N
XLogP1.67
TPSA96.22 Ų
H-Bond Donors3
H-Bond Acceptors5
Rotatable Bonds10
Heavy Atoms21
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500304.38
LogP ≤ 51.67
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 105

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}

Analyze 9-[(3S)-3,5-dihydroxy-6-methyloxan-2-yl]oxynonanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 9-[(3S)-3,5-dihydroxy-6-methyloxan-2-yl]oxynonanoic acid?
The IUPAC name of 9-[(3S)-3,5-dihydroxy-6-methyloxan-2-yl]oxynonanoic acid (CID 144528411) is 9-[(3S)-3,5-dihydroxy-6-methyloxan-2-yl]oxynonanoic acid.
What is the SMILES notation for 9-[(3S)-3,5-dihydroxy-6-methyloxan-2-yl]oxynonanoic acid?
The canonical SMILES for 9-[(3S)-3,5-dihydroxy-6-methyloxan-2-yl]oxynonanoic acid is CC1OC(OCCCCCCCCC(=O)O)[C@@H](O)CC1O.
What is the InChIKey of 9-[(3S)-3,5-dihydroxy-6-methyloxan-2-yl]oxynonanoic acid?
The InChIKey is WGGIJTBDSYSSPD-WRSKWOSUSA-N. The full InChI is InChI=1S/C15H28O6/c1-11-12(16)10-13(17)15(21-11)20-9-7-5-3-2-4-6-8-14(18)19/h11-13,15-17H,2-10H2,1H3,(H,18,19)/t11?,12?,13-,15?/m0/s1.
What are the key properties of 9-[(3S)-3,5-dihydroxy-6-methyloxan-2-yl]oxynonanoic acid?
9-[(3S)-3,5-dihydroxy-6-methyloxan-2-yl]oxynonanoic acid has a molecular weight of 304.38 g/mol, XLogP of 1.67, 10 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 9-[(3S)-3,5-dihydroxy-6-methyloxan-2-yl]oxynonanoic acid is sourced from PubChem (CID 144528411), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).