C13H24Ac3O7 — CID 59891658
actinium;methyl 6-[(2R,5R)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxyhexanoate (PubChem CID 59891658) has the molecular formula C13H24Ac3O7 and a molecular weight of 973.33 g/mol. Its IUPAC name is actinium;methyl 6-[(2R,5R)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxyhexanoate.
| Compound Name | actinium;methyl 6-[(2R,5R)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxyhexanoate |
|---|---|
| PubChem CID | 59891658 |
| Molecular Formula | C13H24Ac3O7 |
| Molecular Weight | 973.33 g/mol |
| Exact Mass | 973.24 |
| IUPAC Name | actinium;methyl 6-[(2R,5R)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxyhexanoate |
| SMILES | COC(=O)CCCCCO[C@@H]1OC(C)[C@H](O)C(O)C1O.[Ac].[Ac].[Ac] |
| InChI | InChI=1S/C13H24O7.3Ac/c1-8-10(15)11(16)12(17)13(20-8)19-7-5-3-4-6-9(14)18-2;;;/h8,10-13,15-17H,3-7H2,1-2H3;;;/t8?,10-,11?,12?,13+;;;/m0.../s1 |
| InChIKey | MFRMHDVVVLZESU-SUHJEUEDSA-N |
| XLogP | -0.44 |
| TPSA | 105.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 973.33 |
| LogP ≤ 5 | -0.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|