C16H28O10 — CID 118976246
2-(hydroxymethyl)-3-[(2R,3S,4S,5S,6S)-3,4,5-trihydroxy-6-(6-methoxy-6-oxohexoxy)oxan-2-yl]propanoic acid (PubChem CID 118976246) has the molecular formula C16H28O10 and a molecular weight of 380.39 g/mol. Its IUPAC name is 2-(hydroxymethyl)-3-[(2R,3S,4S,5S,6S)-3,4,5-trihydroxy-6-(6-methoxy-6-oxohexoxy)oxan-2-yl]propanoic acid.
| Compound Name | 2-(hydroxymethyl)-3-[(2R,3S,4S,5S,6S)-3,4,5-trihydroxy-6-(6-methoxy-6-oxohexoxy)oxan-2-yl]propanoic acid |
|---|---|
| PubChem CID | 118976246 |
| Molecular Formula | C16H28O10 |
| Molecular Weight | 380.39 g/mol |
| Exact Mass | 380.17 |
| IUPAC Name | 2-(hydroxymethyl)-3-[(2R,3S,4S,5S,6S)-3,4,5-trihydroxy-6-(6-methoxy-6-oxohexoxy)oxan-2-yl]propanoic acid |
| SMILES | COC(=O)CCCCCO[C@H]1O[C@H](CC(CO)C(=O)O)[C@@H](O)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C16H28O10/c1-24-11(18)5-3-2-4-6-25-16-14(21)13(20)12(19)10(26-16)7-9(8-17)15(22)23/h9-10,12-14,16-17,19-21H,2-8H2,1H3,(H,22,23)/t9?,10-,12-,13+,14+,16+/m1/s1 |
| InChIKey | IWZNKWFCWNUAOO-WLPFVJOESA-N |
| XLogP | -1.37 |
| TPSA | 162.98 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.39 |
| LogP ≤ 5 | -1.37 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|