C19H32O8 — CID 67858555
methyl 6-[(2S,3R,4S,5S,6R)-5-hydroxy-6-(hydroxymethyl)-3,4-bis(prop-2-enoxy)oxan-2-yl]oxyhexanoate (PubChem CID 67858555) has the molecular formula C19H32O8 and a molecular weight of 388.46 g/mol. Its IUPAC name is methyl 6-[(2S,3R,4S,5S,6R)-5-hydroxy-6-(hydroxymethyl)-3,4-bis(prop-2-enoxy)oxan-2-yl]oxyhexanoate.
| Compound Name | methyl 6-[(2S,3R,4S,5S,6R)-5-hydroxy-6-(hydroxymethyl)-3,4-bis(prop-2-enoxy)oxan-2-yl]oxyhexanoate |
|---|---|
| PubChem CID | 67858555 |
| Molecular Formula | C19H32O8 |
| Molecular Weight | 388.46 g/mol |
| Exact Mass | 388.21 |
| IUPAC Name | methyl 6-[(2S,3R,4S,5S,6R)-5-hydroxy-6-(hydroxymethyl)-3,4-bis(prop-2-enoxy)oxan-2-yl]oxyhexanoate |
| SMILES | C=CCO[C@H]1[C@@H](OCCCCCC(=O)OC)O[C@H](CO)[C@H](O)[C@@H]1OCC=C |
| InChI | InChI=1S/C19H32O8/c1-4-10-24-17-16(22)14(13-20)27-19(18(17)25-11-5-2)26-12-8-6-7-9-15(21)23-3/h4-5,14,16-20,22H,1-2,6-13H2,3H3/t14-,16+,17+,18-,19+/m1/s1 |
| InChIKey | QTRCCXLWLIRHEN-WRNCNIFXSA-N |
| XLogP | 0.96 |
| TPSA | 103.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.46 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|