C16H31NO9 — CID 11783856
N-(2,2-dimethoxyethyl)-6-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyhexanamide (PubChem CID 11783856) has the molecular formula C16H31NO9 and a molecular weight of 381.42 g/mol. Its IUPAC name is N-(2,2-dimethoxyethyl)-6-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyhexanamide.
| Compound Name | N-(2,2-dimethoxyethyl)-6-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyhexanamide |
|---|---|
| PubChem CID | 11783856 |
| Molecular Formula | C16H31NO9 |
| Molecular Weight | 381.42 g/mol |
| Exact Mass | 381.20 |
| IUPAC Name | N-(2,2-dimethoxyethyl)-6-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyhexanamide |
| SMILES | COC(CNC(=O)CCCCCO[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O)OC |
| InChI | InChI=1S/C16H31NO9/c1-23-12(24-2)8-17-11(19)6-4-3-5-7-25-16-15(22)14(21)13(20)10(9-18)26-16/h10,12-16,18,20-22H,3-9H2,1-2H3,(H,17,19)/t10-,13-,14+,15-,16-/m1/s1 |
| InChIKey | YKPXXSBMYAJEFD-LMXXTMHSSA-N |
| XLogP | -1.90 |
| TPSA | 146.94 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.42 |
| LogP ≤ 5 | -1.90 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|