C30H54N2O15 — CID 163707808
N-[(E,5R)-6-methoxy-5-[5-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypentanoylamino]hept-2-enyl]-5-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypentanamide (PubChem CID 163707808) has the molecular formula C30H54N2O15 and a molecular weight of 682.76 g/mol. Its IUPAC name is N-[(E,5R)-6-methoxy-5-[5-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypentanoylamino]hept-2-enyl]-5-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypentanamide.
| Compound Name | N-[(E,5R)-6-methoxy-5-[5-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypentanoylamino]hept-2-enyl]-5-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypentanamide |
|---|---|
| PubChem CID | 163707808 |
| Molecular Formula | C30H54N2O15 |
| Molecular Weight | 682.76 g/mol |
| Exact Mass | 682.35 |
| IUPAC Name | N-[(E,5R)-6-methoxy-5-[5-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypentanoylamino]hept-2-enyl]-5-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypentanamide |
| SMILES | COC(C)[C@@H](C/C=C/CNC(=O)CCCCOC1OC(CO)C(O)C(O)C1O)NC(=O)CCCCOC1OC(CO)C(O)C(O)C1O |
| InChI | InChI=1S/C30H54N2O15/c1-17(43-2)18(32-22(36)11-5-8-14-45-30-28(42)26(40)24(38)20(16-34)47-30)9-3-6-12-31-21(35)10-4-7-13-44-29-27(41)25(39)23(37)19(15-33)46-29/h3,6,17-20,23-30,33-34,37-42H,4-5,7-16H2,1-2H3,(H,31,35)(H,32,36)/b6-3+/t17?,18-,19?,20?,23?,24?,25?,26?,27?,28?,29?,30?/m1/s1 |
| InChIKey | KGPAMXSUPXTNQW-RHYRQPIESA-N |
| XLogP | -3.46 |
| TPSA | 266.19 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 47 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 682.76 |
| LogP ≤ 5 | -3.46 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|