C14H28N2O7 — CID 10664588
N-(2-aminoethyl)-6-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyhexanamide (PubChem CID 10664588) has the molecular formula C14H28N2O7 and a molecular weight of 336.39 g/mol. Its IUPAC name is N-(2-aminoethyl)-6-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyhexanamide.
| Compound Name | N-(2-aminoethyl)-6-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyhexanamide |
|---|---|
| PubChem CID | 10664588 |
| Molecular Formula | C14H28N2O7 |
| Molecular Weight | 336.39 g/mol |
| Exact Mass | 336.19 |
| IUPAC Name | N-(2-aminoethyl)-6-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyhexanamide |
| SMILES | NCCNC(=O)CCCCCO[C@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C14H28N2O7/c15-5-6-16-10(18)4-2-1-3-7-22-14-13(21)12(20)11(19)9(8-17)23-14/h9,11-14,17,19-21H,1-8,15H2,(H,16,18)/t9-,11-,12+,13-,14+/m1/s1 |
| InChIKey | GSJCRSUXXFIRKL-LPUQOGTASA-N |
| XLogP | -2.56 |
| TPSA | 154.50 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.39 |
| LogP ≤ 5 | -2.56 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|