C19H39N3O7 — CID 18609356
N-(2-aminoethyl)-8-[2-[(2R,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyethylamino]nonanamide (PubChem CID 18609356) has the molecular formula C19H39N3O7 and a molecular weight of 421.54 g/mol. Its IUPAC name is N-(2-aminoethyl)-8-[2-[(2R,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyethylamino]nonanamide.
| Compound Name | N-(2-aminoethyl)-8-[2-[(2R,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyethylamino]nonanamide |
|---|---|
| PubChem CID | 18609356 |
| Molecular Formula | C19H39N3O7 |
| Molecular Weight | 421.54 g/mol |
| Exact Mass | 421.28 |
| IUPAC Name | N-(2-aminoethyl)-8-[2-[(2R,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyethylamino]nonanamide |
| SMILES | CC(CCCCCCC(=O)NCCN)NCCO[C@@H]1O[C@H](CO)[C@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C19H39N3O7/c1-13(6-4-2-3-5-7-15(24)22-9-8-20)21-10-11-28-19-18(27)17(26)16(25)14(12-23)29-19/h13-14,16-19,21,23,25-27H,2-12,20H2,1H3,(H,22,24)/t13?,14-,16+,17+,18-,19-/m1/s1 |
| InChIKey | NOIVLCIZABVNIG-TVMOWAEESA-N |
| XLogP | -1.80 |
| TPSA | 166.53 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.54 |
| LogP ≤ 5 | -1.80 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|