C14H25NO9 — CID 101220012
methyl 2-methyl-4-oxo-4-[2-[(2S,3S,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyethylamino]butanoate (PubChem CID 101220012) has the molecular formula C14H25NO9 and a molecular weight of 351.35 g/mol. Its IUPAC name is methyl 2-methyl-4-oxo-4-[2-[(2S,3S,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyethylamino]butanoate.
| Compound Name | methyl 2-methyl-4-oxo-4-[2-[(2S,3S,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyethylamino]butanoate |
|---|---|
| PubChem CID | 101220012 |
| Molecular Formula | C14H25NO9 |
| Molecular Weight | 351.35 g/mol |
| Exact Mass | 351.15 |
| IUPAC Name | methyl 2-methyl-4-oxo-4-[2-[(2S,3S,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyethylamino]butanoate |
| SMILES | COC(=O)C(C)CC(=O)NCCO[C@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C14H25NO9/c1-7(13(21)22-2)5-9(17)15-3-4-23-14-12(20)11(19)10(18)8(6-16)24-14/h7-8,10-12,14,16,18-20H,3-6H2,1-2H3,(H,15,17)/t7?,8-,10-,11+,12+,14+/m1/s1 |
| InChIKey | PUBRPVPLPMRVKV-IGXHOCIJSA-N |
| XLogP | -2.88 |
| TPSA | 154.78 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.35 |
| LogP ≤ 5 | -2.88 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|