C13H25NO8 — CID 10860275
tert-butyl N-[2-[(2R,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyethyl]carbamate (PubChem CID 10860275) has the molecular formula C13H25NO8 and a molecular weight of 323.34 g/mol. Its IUPAC name is tert-butyl N-[2-[(2R,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyethyl]carbamate.
| Compound Name | tert-butyl N-[2-[(2R,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyethyl]carbamate |
|---|---|
| PubChem CID | 10860275 |
| Molecular Formula | C13H25NO8 |
| Molecular Weight | 323.34 g/mol |
| Exact Mass | 323.16 |
| IUPAC Name | tert-butyl N-[2-[(2R,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCO[C@@H]1O[C@H](CO)[C@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C13H25NO8/c1-13(2,3)22-12(19)14-4-5-20-11-10(18)9(17)8(16)7(6-15)21-11/h7-11,15-18H,4-6H2,1-3H3,(H,14,19)/t7-,8+,9+,10-,11-/m1/s1 |
| InChIKey | YKBYJCGFGSTTEL-ZKKRXERASA-N |
| XLogP | -1.67 |
| TPSA | 137.71 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.34 |
| LogP ≤ 5 | -1.67 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|