C23H44N2O14S — CID 11664411
2-[2-[2-[2-[2-[2-[(2-sulfanylacetyl)amino]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethyl N-[2-[(2S,3S,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyethyl]carbamate (PubChem CID 11664411) has the molecular formula C23H44N2O14S and a molecular weight of 604.67 g/mol. Its IUPAC name is 2-[2-[2-[2-[2-[2-[(2-sulfanylacetyl)amino]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethyl N-[2-[(2S,3S,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyethyl]carbamate.
| Compound Name | 2-[2-[2-[2-[2-[2-[(2-sulfanylacetyl)amino]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethyl N-[2-[(2S,3S,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyethyl]carbamate |
|---|---|
| PubChem CID | 11664411 |
| Molecular Formula | C23H44N2O14S |
| Molecular Weight | 604.67 g/mol |
| Exact Mass | 604.25 |
| IUPAC Name | 2-[2-[2-[2-[2-[2-[(2-sulfanylacetyl)amino]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethyl N-[2-[(2S,3S,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyethyl]carbamate |
| SMILES | O=C(CS)NCCOCCOCCOCCOCCOCCOC(=O)NCCO[C@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C23H44N2O14S/c26-15-17-19(28)20(29)21(30)22(39-17)37-4-2-25-23(31)38-14-13-36-12-11-35-10-9-34-8-7-33-6-5-32-3-1-24-18(27)16-40/h17,19-22,26,28-30,40H,1-16H2,(H,24,27)(H,25,31)/t17-,19-,20+,21+,22+/m1/s1 |
| InChIKey | PECKMJCLBQDYSE-ICGSVKGVSA-N |
| XLogP | -3.34 |
| TPSA | 212.96 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 40 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.67 |
| LogP ≤ 5 | -3.34 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|