C24H49NO7 — CID 158564821
6-[4,5-dihydroxy-6-(hydroxymethyl)-3-methyloxan-2-yl]oxy-N-(6-methoxyhexyl)hexanamide;2-methylpropane (PubChem CID 158564821) has the molecular formula C24H49NO7 and a molecular weight of 463.66 g/mol. Its IUPAC name is 6-[4,5-dihydroxy-6-(hydroxymethyl)-3-methyloxan-2-yl]oxy-N-(6-methoxyhexyl)hexanamide;2-methylpropane.
| Compound Name | 6-[4,5-dihydroxy-6-(hydroxymethyl)-3-methyloxan-2-yl]oxy-N-(6-methoxyhexyl)hexanamide;2-methylpropane |
|---|---|
| PubChem CID | 158564821 |
| Molecular Formula | C24H49NO7 |
| Molecular Weight | 463.66 g/mol |
| Exact Mass | 463.35 |
| IUPAC Name | 6-[4,5-dihydroxy-6-(hydroxymethyl)-3-methyloxan-2-yl]oxy-N-(6-methoxyhexyl)hexanamide;2-methylpropane |
| SMILES | CC(C)C.COCCCCCCNC(=O)CCCCCOC1OC(CO)C(O)C(O)C1C |
| InChI | InChI=1S/C20H39NO7.C4H10/c1-15-18(24)19(25)16(14-22)28-20(15)27-13-9-5-6-10-17(23)21-11-7-3-4-8-12-26-2;1-4(2)3/h15-16,18-20,22,24-25H,3-14H2,1-2H3,(H,21,23);4H,1-3H3 |
| InChIKey | HRILPFSAWNRBBM-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 117.48 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.66 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|