C22H43NO7 — CID 121310105
6-[(2R,3S,5R)-4,5-dihydroxy-6-(hydroxymethyl)-3-methyloxan-2-yl]oxy-N-(6-propan-2-yloxyhexyl)hexanamide (PubChem CID 121310105) has the molecular formula C22H43NO7 and a molecular weight of 433.59 g/mol. Its IUPAC name is 6-[(2R,3S,5R)-4,5-dihydroxy-6-(hydroxymethyl)-3-methyloxan-2-yl]oxy-N-(6-propan-2-yloxyhexyl)hexanamide.
| Compound Name | 6-[(2R,3S,5R)-4,5-dihydroxy-6-(hydroxymethyl)-3-methyloxan-2-yl]oxy-N-(6-propan-2-yloxyhexyl)hexanamide |
|---|---|
| PubChem CID | 121310105 |
| Molecular Formula | C22H43NO7 |
| Molecular Weight | 433.59 g/mol |
| Exact Mass | 433.30 |
| IUPAC Name | 6-[(2R,3S,5R)-4,5-dihydroxy-6-(hydroxymethyl)-3-methyloxan-2-yl]oxy-N-(6-propan-2-yloxyhexyl)hexanamide |
| SMILES | CC(C)OCCCCCCNC(=O)CCCCCO[C@@H]1OC(CO)[C@H](O)C(O)[C@@H]1C |
| InChI | InChI=1S/C22H43NO7/c1-16(2)28-13-9-5-4-8-12-23-19(25)11-7-6-10-14-29-22-17(3)20(26)21(27)18(15-24)30-22/h16-18,20-22,24,26-27H,4-15H2,1-3H3,(H,23,25)/t17-,18?,20?,21-,22+/m0/s1 |
| InChIKey | OJKFIMBRDIDOCE-ZFLWSFLBSA-N |
| XLogP | 1.74 |
| TPSA | 117.48 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.59 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|