C18H35NO6 — CID 130196068
4-[4,5-dihydroxy-6-(hydroxymethyl)-3-methyloxan-2-yl]oxy-N-heptylbutanamide (PubChem CID 130196068) has the molecular formula C18H35NO6 and a molecular weight of 361.48 g/mol. Its IUPAC name is 4-[4,5-dihydroxy-6-(hydroxymethyl)-3-methyloxan-2-yl]oxy-N-heptylbutanamide.
| Compound Name | 4-[4,5-dihydroxy-6-(hydroxymethyl)-3-methyloxan-2-yl]oxy-N-heptylbutanamide |
|---|---|
| PubChem CID | 130196068 |
| Molecular Formula | C18H35NO6 |
| Molecular Weight | 361.48 g/mol |
| Exact Mass | 361.25 |
| IUPAC Name | 4-[4,5-dihydroxy-6-(hydroxymethyl)-3-methyloxan-2-yl]oxy-N-heptylbutanamide |
| SMILES | CCCCCCCNC(=O)CCCOC1OC(CO)C(O)C(O)C1C |
| InChI | InChI=1S/C18H35NO6/c1-3-4-5-6-7-10-19-15(21)9-8-11-24-18-13(2)16(22)17(23)14(12-20)25-18/h13-14,16-18,20,22-23H,3-12H2,1-2H3,(H,19,21) |
| InChIKey | BWBIREFBNXVFOZ-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 108.25 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.48 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|