C16H31NO7 — CID 102322034
N-octyl-2-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyacetamide (PubChem CID 102322034) has the molecular formula C16H31NO7 and a molecular weight of 349.42 g/mol. Its IUPAC name is N-octyl-2-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyacetamide.
| Compound Name | N-octyl-2-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyacetamide |
|---|---|
| PubChem CID | 102322034 |
| Molecular Formula | C16H31NO7 |
| Molecular Weight | 349.42 g/mol |
| Exact Mass | 349.21 |
| IUPAC Name | N-octyl-2-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyacetamide |
| SMILES | CCCCCCCCNC(=O)CO[C@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C16H31NO7/c1-2-3-4-5-6-7-8-17-12(19)10-23-16-15(22)14(21)13(20)11(9-18)24-16/h11,13-16,18,20-22H,2-10H2,1H3,(H,17,19)/t11-,13-,14+,15-,16+/m1/s1 |
| InChIKey | XVQLVBBWHSMADW-JZYAIQKZSA-N |
| XLogP | -0.72 |
| TPSA | 128.48 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.42 |
| LogP ≤ 5 | -0.72 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|