C43H79N3O15 — CID 157057143
(9S)-9,13-bis[6-[4,5-dihydroxy-6-(hydroxymethyl)-3-methyloxan-2-yl]oxyhexanoylamino]-N-(3-methoxypropyl)-8-oxotridecanamide (PubChem CID 157057143) has the molecular formula C43H79N3O15 and a molecular weight of 878.11 g/mol. Its IUPAC name is (9S)-9,13-bis[6-[4,5-dihydroxy-6-(hydroxymethyl)-3-methyloxan-2-yl]oxyhexanoylamino]-N-(3-methoxypropyl)-8-oxotridecanamide.
| Compound Name | (9S)-9,13-bis[6-[4,5-dihydroxy-6-(hydroxymethyl)-3-methyloxan-2-yl]oxyhexanoylamino]-N-(3-methoxypropyl)-8-oxotridecanamide |
|---|---|
| PubChem CID | 157057143 |
| Molecular Formula | C43H79N3O15 |
| Molecular Weight | 878.11 g/mol |
| Exact Mass | 877.55 |
| IUPAC Name | (9S)-9,13-bis[6-[4,5-dihydroxy-6-(hydroxymethyl)-3-methyloxan-2-yl]oxyhexanoylamino]-N-(3-methoxypropyl)-8-oxotridecanamide |
| SMILES | COCCCNC(=O)CCCCCCC(=O)[C@H](CCCCNC(=O)CCCCCOC1OC(CO)C(O)C(O)C1C)NC(=O)CCCCCOC1OC(CO)C(O)C(O)C1C |
| InChI | InChI=1S/C43H79N3O15/c1-29-38(53)40(55)33(27-47)60-42(29)58-25-14-6-10-20-35(50)44-22-13-12-17-31(32(49)18-8-4-5-9-19-36(51)45-23-16-24-57-3)46-37(52)21-11-7-15-26-59-43-30(2)39(54)41(56)34(28-48)61-43/h29-31,33-34,38-43,47-48,53-56H,4-28H2,1-3H3,(H,44,50)(H,45,51)(H,46,52)/t29?,30?,31-,33?,34?,38?,39?,40?,41?,42?,43?/m0/s1 |
| InChIKey | RSDXFWHCODKYKL-ZABGFQCXSA-N |
| XLogP | 1.12 |
| TPSA | 271.90 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 34 |
| Heavy Atoms | 61 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 878.11 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|