C16H31NO6 — CID 167670265
6-[(2R,4R,5R)-5-hydroxy-6-(hydroxymethyl)-3,4-dimethyloxan-2-yl]oxy-N-(methoxymethyl)hexanamide (PubChem CID 167670265) has the molecular formula C16H31NO6 and a molecular weight of 333.43 g/mol. Its IUPAC name is 6-[(2R,4R,5R)-5-hydroxy-6-(hydroxymethyl)-3,4-dimethyloxan-2-yl]oxy-N-(methoxymethyl)hexanamide.
| Compound Name | 6-[(2R,4R,5R)-5-hydroxy-6-(hydroxymethyl)-3,4-dimethyloxan-2-yl]oxy-N-(methoxymethyl)hexanamide |
|---|---|
| PubChem CID | 167670265 |
| Molecular Formula | C16H31NO6 |
| Molecular Weight | 333.43 g/mol |
| Exact Mass | 333.22 |
| IUPAC Name | 6-[(2R,4R,5R)-5-hydroxy-6-(hydroxymethyl)-3,4-dimethyloxan-2-yl]oxy-N-(methoxymethyl)hexanamide |
| SMILES | COCNC(=O)CCCCCO[C@@H]1OC(CO)[C@H](O)[C@H](C)C1C |
| InChI | InChI=1S/C16H31NO6/c1-11-12(2)16(23-13(9-18)15(11)20)22-8-6-4-5-7-14(19)17-10-21-3/h11-13,15-16,18,20H,4-10H2,1-3H3,(H,17,19)/t11-,12?,13?,15-,16-/m1/s1 |
| InChIKey | OAIXHPCVNMDTOM-GWROUVMCSA-N |
| XLogP | 0.63 |
| TPSA | 97.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.43 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|