C14H27O10P — CID 66847720
2-[(2R,3S,4S,5S,6S)-3,4,5-trihydroxy-6-(6-methoxy-6-oxohexoxy)oxan-2-yl]ethylphosphonic acid (PubChem CID 66847720) has the molecular formula C14H27O10P and a molecular weight of 386.33 g/mol. Its IUPAC name is 2-[(2R,3S,4S,5S,6S)-3,4,5-trihydroxy-6-(6-methoxy-6-oxohexoxy)oxan-2-yl]ethylphosphonic acid.
| Compound Name | 2-[(2R,3S,4S,5S,6S)-3,4,5-trihydroxy-6-(6-methoxy-6-oxohexoxy)oxan-2-yl]ethylphosphonic acid |
|---|---|
| PubChem CID | 66847720 |
| Molecular Formula | C14H27O10P |
| Molecular Weight | 386.33 g/mol |
| Exact Mass | 386.13 |
| IUPAC Name | 2-[(2R,3S,4S,5S,6S)-3,4,5-trihydroxy-6-(6-methoxy-6-oxohexoxy)oxan-2-yl]ethylphosphonic acid |
| SMILES | COC(=O)CCCCCO[C@H]1O[C@H](CCP(=O)(O)O)[C@@H](O)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C14H27O10P/c1-22-10(15)5-3-2-4-7-23-14-13(18)12(17)11(16)9(24-14)6-8-25(19,20)21/h9,11-14,16-18H,2-8H2,1H3,(H2,19,20,21)/t9-,11-,12+,13+,14+/m1/s1 |
| InChIKey | PSQMQKOGVGQXPH-CYDRSHDDSA-N |
| XLogP | -0.89 |
| TPSA | 162.98 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.33 |
| LogP ≤ 5 | -0.89 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|