C24H44O17PY- — CID 159279467
2-[(3,4,5-trihydroxy-6-pentoxyoxan-2-yl)methyl]propanedioic acid;2-(3,4,5-trihydroxy-6-propoxyoxan-2-yl)ethylphosphonic acid;yttrium (PubChem CID 159279467) has the molecular formula C24H44O17PY- and a molecular weight of 724.48 g/mol. Its IUPAC name is 2-[(3,4,5-trihydroxy-6-pentoxyoxan-2-yl)methyl]propanedioic acid;2-(3,4,5-trihydroxy-6-propoxyoxan-2-yl)ethylphosphonic acid;yttrium.
| Compound Name | 2-[(3,4,5-trihydroxy-6-pentoxyoxan-2-yl)methyl]propanedioic acid;2-(3,4,5-trihydroxy-6-propoxyoxan-2-yl)ethylphosphonic acid;yttrium |
|---|---|
| PubChem CID | 159279467 |
| Molecular Formula | C24H44O17PY- |
| Molecular Weight | 724.48 g/mol |
| Exact Mass | 724.14 |
| IUPAC Name | 2-[(3,4,5-trihydroxy-6-pentoxyoxan-2-yl)methyl]propanedioic acid;2-(3,4,5-trihydroxy-6-propoxyoxan-2-yl)ethylphosphonic acid;yttrium |
| SMILES | CCCOC1OC(CCP(=O)(O)O)C(O)C(O)C1O.[CH2-]CCCCOC1OC(CC(C(=O)O)C(=O)O)C(O)C(O)C1O.[Y] |
| InChI | InChI=1S/C14H23O9.C10H21O8P.Y/c1-2-3-4-5-22-14-11(17)10(16)9(15)8(23-14)6-7(12(18)19)13(20)21;1-2-4-17-10-9(13)8(12)7(11)6(18-10)3-5-19(14,15)16;/h7-11,14-17H,1-6H2,(H,18,19)(H,20,21);6-13H,2-5H2,1H3,(H2,14,15,16);/q-1;; |
| InChIKey | QGQODDBCFXRCPT-UHFFFAOYSA-N |
| XLogP | -2.22 |
| TPSA | 290.43 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 43 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 724.48 |
| LogP ≤ 5 | -2.22 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|