C9H20NO8P — CID 140910677
2-[(3S,4S,6S)-6-(2-aminoethoxy)-3,4,5-trihydroxyoxan-2-yl]ethylphosphonic acid (PubChem CID 140910677) has the molecular formula C9H20NO8P and a molecular weight of 301.23 g/mol. Its IUPAC name is 2-[(3S,4S,6S)-6-(2-aminoethoxy)-3,4,5-trihydroxyoxan-2-yl]ethylphosphonic acid.
| Compound Name | 2-[(3S,4S,6S)-6-(2-aminoethoxy)-3,4,5-trihydroxyoxan-2-yl]ethylphosphonic acid |
|---|---|
| PubChem CID | 140910677 |
| Molecular Formula | C9H20NO8P |
| Molecular Weight | 301.23 g/mol |
| Exact Mass | 301.09 |
| IUPAC Name | 2-[(3S,4S,6S)-6-(2-aminoethoxy)-3,4,5-trihydroxyoxan-2-yl]ethylphosphonic acid |
| SMILES | NCCO[C@H]1OC(CCP(=O)(O)O)[C@@H](O)[C@H](O)C1O |
| InChI | InChI=1S/C9H20NO8P/c10-2-3-17-9-8(13)7(12)6(11)5(18-9)1-4-19(14,15)16/h5-9,11-13H,1-4,10H2,(H2,14,15,16)/t5?,6-,7+,8?,9+/m1/s1 |
| InChIKey | KXLOEDUVDOTQNT-IPVXCSAOSA-N |
| XLogP | -2.66 |
| TPSA | 162.70 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.23 |
| LogP ≤ 5 | -2.66 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|