C11H23O8P — CID 170449213
2-[(2R,3S,4S,5S)-3,4,5-trihydroxy-6-[(2-methylpropan-2-yl)oxy]oxan-2-yl]ethylphosphonic acid (PubChem CID 170449213) has the molecular formula C11H23O8P and a molecular weight of 314.27 g/mol. Its IUPAC name is 2-[(2R,3S,4S,5S)-3,4,5-trihydroxy-6-[(2-methylpropan-2-yl)oxy]oxan-2-yl]ethylphosphonic acid.
| Compound Name | 2-[(2R,3S,4S,5S)-3,4,5-trihydroxy-6-[(2-methylpropan-2-yl)oxy]oxan-2-yl]ethylphosphonic acid |
|---|---|
| PubChem CID | 170449213 |
| Molecular Formula | C11H23O8P |
| Molecular Weight | 314.27 g/mol |
| Exact Mass | 314.11 |
| IUPAC Name | 2-[(2R,3S,4S,5S)-3,4,5-trihydroxy-6-[(2-methylpropan-2-yl)oxy]oxan-2-yl]ethylphosphonic acid |
| SMILES | CC(C)(C)OC1O[C@H](CCP(=O)(O)O)[C@@H](O)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C11H23O8P/c1-11(2,3)19-10-9(14)8(13)7(12)6(18-10)4-5-20(15,16)17/h6-10,12-14H,4-5H2,1-3H3,(H2,15,16,17)/t6-,7-,8+,9+,10?/m1/s1 |
| InChIKey | NIMRXJZJSLACHP-NTUKYRGVSA-N |
| XLogP | -0.82 |
| TPSA | 136.68 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.27 |
| LogP ≤ 5 | -0.82 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|