C14H23O8P — CID 176556373
2-[(3S,6R)-6-[(3E,5Z)-hepta-1,3,5-trien-3-yl]oxy-3,4,5-trihydroxyoxan-2-yl]ethylphosphonic acid (PubChem CID 176556373) has the molecular formula C14H23O8P and a molecular weight of 350.30 g/mol. Its IUPAC name is 2-[(3S,6R)-6-[(3E,5Z)-hepta-1,3,5-trien-3-yl]oxy-3,4,5-trihydroxyoxan-2-yl]ethylphosphonic acid.
| Compound Name | 2-[(3S,6R)-6-[(3E,5Z)-hepta-1,3,5-trien-3-yl]oxy-3,4,5-trihydroxyoxan-2-yl]ethylphosphonic acid |
|---|---|
| PubChem CID | 176556373 |
| Molecular Formula | C14H23O8P |
| Molecular Weight | 350.30 g/mol |
| Exact Mass | 350.11 |
| IUPAC Name | 2-[(3S,6R)-6-[(3E,5Z)-hepta-1,3,5-trien-3-yl]oxy-3,4,5-trihydroxyoxan-2-yl]ethylphosphonic acid |
| SMILES | C=C/C(=C\C=C/C)O[C@H]1OC(CCP(=O)(O)O)[C@@H](O)C(O)C1O |
| InChI | InChI=1S/C14H23O8P/c1-3-5-6-9(4-2)21-14-13(17)12(16)11(15)10(22-14)7-8-23(18,19)20/h3-6,10-17H,2,7-8H2,1H3,(H2,18,19,20)/b5-3-,9-6+/t10?,11-,12?,13?,14+/m1/s1 |
| InChIKey | UYCJPZOYUZPPAT-QQXHCACLSA-N |
| XLogP | 0.02 |
| TPSA | 136.68 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.30 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|