C18H31O7P — CID 176556234
propan-2-yloxy-[2-[(3S,6R)-3,4,5-trihydroxy-6-[(3E,5Z)-octa-3,5,7-trien-3-yl]oxyoxan-2-yl]ethyl]phosphinous acid (PubChem CID 176556234) has the molecular formula C18H31O7P and a molecular weight of 390.41 g/mol. Its IUPAC name is propan-2-yloxy-[2-[(3S,6R)-3,4,5-trihydroxy-6-[(3E,5Z)-octa-3,5,7-trien-3-yl]oxyoxan-2-yl]ethyl]phosphinous acid.
| Compound Name | propan-2-yloxy-[2-[(3S,6R)-3,4,5-trihydroxy-6-[(3E,5Z)-octa-3,5,7-trien-3-yl]oxyoxan-2-yl]ethyl]phosphinous acid |
|---|---|
| PubChem CID | 176556234 |
| Molecular Formula | C18H31O7P |
| Molecular Weight | 390.41 g/mol |
| Exact Mass | 390.18 |
| IUPAC Name | propan-2-yloxy-[2-[(3S,6R)-3,4,5-trihydroxy-6-[(3E,5Z)-octa-3,5,7-trien-3-yl]oxyoxan-2-yl]ethyl]phosphinous acid |
| SMILES | C=C/C=C\C=C(/CC)O[C@H]1OC(CCP(O)OC(C)C)[C@@H](O)C(O)C1O |
| InChI | InChI=1S/C18H31O7P/c1-5-7-8-9-13(6-2)23-18-17(21)16(20)15(19)14(24-18)10-11-26(22)25-12(3)4/h5,7-9,12,14-22H,1,6,10-11H2,2-4H3/b8-7-,13-9+/t14?,15-,16?,17?,18+,26?/m1/s1 |
| InChIKey | HEQWBDDBMSHHSP-RVEZBIJQSA-N |
| XLogP | 1.97 |
| TPSA | 108.61 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.41 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|