C9H15O7P — CID 166479180
2-[(2R,3S,4S,5S,6R)-6-ethynyl-3,4,5-trihydroxyoxan-2-yl]ethylphosphonic acid (PubChem CID 166479180) has the molecular formula C9H15O7P and a molecular weight of 266.19 g/mol. Its IUPAC name is 2-[(2R,3S,4S,5S,6R)-6-ethynyl-3,4,5-trihydroxyoxan-2-yl]ethylphosphonic acid.
| Compound Name | 2-[(2R,3S,4S,5S,6R)-6-ethynyl-3,4,5-trihydroxyoxan-2-yl]ethylphosphonic acid |
|---|---|
| PubChem CID | 166479180 |
| Molecular Formula | C9H15O7P |
| Molecular Weight | 266.19 g/mol |
| Exact Mass | 266.06 |
| IUPAC Name | 2-[(2R,3S,4S,5S,6R)-6-ethynyl-3,4,5-trihydroxyoxan-2-yl]ethylphosphonic acid |
| SMILES | C#C[C@H]1O[C@H](CCP(=O)(O)O)[C@@H](O)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C9H15O7P/c1-2-5-7(10)9(12)8(11)6(16-5)3-4-17(13,14)15/h1,5-12H,3-4H2,(H2,13,14,15)/t5-,6-,7-,8-,9-/m1/s1 |
| InChIKey | IDVCLLWRNXFSLX-JGKVKWKGSA-N |
| XLogP | -1.96 |
| TPSA | 127.45 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.19 |
| LogP ≤ 5 | -1.96 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|