C11H18N3O7P — CID 167491247
2-[(2R,3S,4S,5S)-3,4,5-trihydroxy-6-(pyrimidin-2-ylamino)oxan-2-yl]ethylphosphonic acid (PubChem CID 167491247) has the molecular formula C11H18N3O7P and a molecular weight of 335.25 g/mol. Its IUPAC name is 2-[(2R,3S,4S,5S)-3,4,5-trihydroxy-6-(pyrimidin-2-ylamino)oxan-2-yl]ethylphosphonic acid.
| Compound Name | 2-[(2R,3S,4S,5S)-3,4,5-trihydroxy-6-(pyrimidin-2-ylamino)oxan-2-yl]ethylphosphonic acid |
|---|---|
| PubChem CID | 167491247 |
| Molecular Formula | C11H18N3O7P |
| Molecular Weight | 335.25 g/mol |
| Exact Mass | 335.09 |
| IUPAC Name | 2-[(2R,3S,4S,5S)-3,4,5-trihydroxy-6-(pyrimidin-2-ylamino)oxan-2-yl]ethylphosphonic acid |
| SMILES | O=P(O)(O)CC[C@H]1OC(Nc2ncccn2)[C@@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C11H18N3O7P/c15-7-6(2-5-22(18,19)20)21-10(9(17)8(7)16)14-11-12-3-1-4-13-11/h1,3-4,6-10,15-17H,2,5H2,(H,12,13,14)(H2,18,19,20)/t6-,7-,8+,9+,10?/m1/s1 |
| InChIKey | PCWPUVOKSHZTLL-NTUKYRGVSA-N |
| XLogP | -1.74 |
| TPSA | 165.26 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.25 |
| LogP ≤ 5 | -1.74 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|