C11H23O7P — CID 168749628
2-[(2R,3S,4R,5S,6R)-3,4,5-trihydroxy-6-(2-methylpropyl)oxan-2-yl]ethylphosphonic acid (PubChem CID 168749628) has the molecular formula C11H23O7P and a molecular weight of 298.27 g/mol. Its IUPAC name is 2-[(2R,3S,4R,5S,6R)-3,4,5-trihydroxy-6-(2-methylpropyl)oxan-2-yl]ethylphosphonic acid.
| Compound Name | 2-[(2R,3S,4R,5S,6R)-3,4,5-trihydroxy-6-(2-methylpropyl)oxan-2-yl]ethylphosphonic acid |
|---|---|
| PubChem CID | 168749628 |
| Molecular Formula | C11H23O7P |
| Molecular Weight | 298.27 g/mol |
| Exact Mass | 298.12 |
| IUPAC Name | 2-[(2R,3S,4R,5S,6R)-3,4,5-trihydroxy-6-(2-methylpropyl)oxan-2-yl]ethylphosphonic acid |
| SMILES | CC(C)C[C@H]1O[C@H](CCP(=O)(O)O)[C@@H](O)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C11H23O7P/c1-6(2)5-8-10(13)11(14)9(12)7(18-8)3-4-19(15,16)17/h6-14H,3-5H2,1-2H3,(H2,15,16,17)/t7-,8-,9-,10-,11+/m1/s1 |
| InChIKey | QGTFZIYTCWHCSO-ILAIQSSSSA-N |
| XLogP | -0.55 |
| TPSA | 127.45 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.27 |
| LogP ≤ 5 | -0.55 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|