C13H27N2Na2O9P — CID 66847635
CID 66847635 (PubChem CID 66847635) has the molecular formula C13H27N2Na2O9P and a molecular weight of 432.32 g/mol.
| Compound Name | CID 66847635 |
|---|---|
| PubChem CID | 66847635 |
| Molecular Formula | C13H27N2Na2O9P |
| Molecular Weight | 432.32 g/mol |
| Exact Mass | 432.12 |
| IUPAC Name | — |
| SMILES | NNC(=O)CCCCCO[C@H]1O[C@H](CCP(=O)(O)O)[C@@H](O)[C@H](O)[C@@H]1O.[Na].[Na] |
| InChI | InChI=1S/C13H27N2O9P.2Na/c14-15-9(16)4-2-1-3-6-23-13-12(19)11(18)10(17)8(24-13)5-7-25(20,21)22;;/h8,10-13,17-19H,1-7,14H2,(H,15,16)(H2,20,21,22);;/t8-,10-,11+,12+,13+;;/m1../s1 |
| InChIKey | AHWWDINEYCPXFX-KMGJVPEMSA-N |
| XLogP | -2.83 |
| TPSA | 191.80 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.32 |
| LogP ≤ 5 | -2.83 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|