C19H36O7 — CID 18650121
[(2R,3S,4S,5R)-6-butoxy-3,4,5-trihydroxyoxan-2-yl]methyl nonanoate (PubChem CID 18650121) has the molecular formula C19H36O7 and a molecular weight of 376.49 g/mol. Its IUPAC name is [(2R,3S,4S,5R)-6-butoxy-3,4,5-trihydroxyoxan-2-yl]methyl nonanoate.
| Compound Name | [(2R,3S,4S,5R)-6-butoxy-3,4,5-trihydroxyoxan-2-yl]methyl nonanoate |
|---|---|
| PubChem CID | 18650121 |
| Molecular Formula | C19H36O7 |
| Molecular Weight | 376.49 g/mol |
| Exact Mass | 376.25 |
| IUPAC Name | [(2R,3S,4S,5R)-6-butoxy-3,4,5-trihydroxyoxan-2-yl]methyl nonanoate |
| SMILES | CCCCCCCCC(=O)OC[C@H]1OC(OCCCC)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C19H36O7/c1-3-5-7-8-9-10-11-15(20)25-13-14-16(21)17(22)18(23)19(26-14)24-12-6-4-2/h14,16-19,21-23H,3-13H2,1-2H3/t14-,16-,17+,18-,19?/m1/s1 |
| InChIKey | BOFWNXMGIPJXJT-ILNABNIYSA-N |
| XLogP | 1.90 |
| TPSA | 105.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.49 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|