C28H48O7 — CID 67800551
[(2R,3S,4S,5R)-6-butoxy-3,4,5-trihydroxyoxan-2-yl]methyl (9Z,12Z,15Z)-octadeca-9,12,15-trienoate (PubChem CID 67800551) has the molecular formula C28H48O7 and a molecular weight of 496.69 g/mol. Its IUPAC name is [(2R,3S,4S,5R)-6-butoxy-3,4,5-trihydroxyoxan-2-yl]methyl (9Z,12Z,15Z)-octadeca-9,12,15-trienoate.
| Compound Name | [(2R,3S,4S,5R)-6-butoxy-3,4,5-trihydroxyoxan-2-yl]methyl (9Z,12Z,15Z)-octadeca-9,12,15-trienoate |
|---|---|
| PubChem CID | 67800551 |
| Molecular Formula | C28H48O7 |
| Molecular Weight | 496.69 g/mol |
| Exact Mass | 496.34 |
| IUPAC Name | [(2R,3S,4S,5R)-6-butoxy-3,4,5-trihydroxyoxan-2-yl]methyl (9Z,12Z,15Z)-octadeca-9,12,15-trienoate |
| SMILES | CC/C=C\C/C=C\C/C=C\CCCCCCCC(=O)OC[C@H]1OC(OCCCC)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C28H48O7/c1-3-5-7-8-9-10-11-12-13-14-15-16-17-18-19-20-24(29)34-22-23-25(30)26(31)27(32)28(35-23)33-21-6-4-2/h5,7,9-10,12-13,23,25-28,30-32H,3-4,6,8,11,14-22H2,1-2H3/b7-5-,10-9-,13-12-/t23-,25-,26+,27-,28?/m1/s1 |
| InChIKey | HKMYPFUCELMDTP-NRCHUOADSA-N |
| XLogP | 4.74 |
| TPSA | 105.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.69 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|