C27H46O7 — CID 67800482
[(2R,3S,4S,5R,6S)-3,4,5-trihydroxy-6-propan-2-yloxyoxan-2-yl]methyl (9Z,12Z)-octadeca-9,12,15-trienoate (PubChem CID 67800482) has the molecular formula C27H46O7 and a molecular weight of 482.66 g/mol. Its IUPAC name is [(2R,3S,4S,5R,6S)-3,4,5-trihydroxy-6-propan-2-yloxyoxan-2-yl]methyl (9Z,12Z)-octadeca-9,12,15-trienoate.
| Compound Name | [(2R,3S,4S,5R,6S)-3,4,5-trihydroxy-6-propan-2-yloxyoxan-2-yl]methyl (9Z,12Z)-octadeca-9,12,15-trienoate |
|---|---|
| PubChem CID | 67800482 |
| Molecular Formula | C27H46O7 |
| Molecular Weight | 482.66 g/mol |
| Exact Mass | 482.32 |
| IUPAC Name | [(2R,3S,4S,5R,6S)-3,4,5-trihydroxy-6-propan-2-yloxyoxan-2-yl]methyl (9Z,12Z)-octadeca-9,12,15-trienoate |
| SMILES | CCC=CC/C=C\C/C=C\CCCCCCCC(=O)OC[C@H]1O[C@H](OC(C)C)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C27H46O7/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-23(28)32-20-22-24(29)25(30)26(31)27(34-22)33-21(2)3/h5-6,8-9,11-12,21-22,24-27,29-31H,4,7,10,13-20H2,1-3H3/b6-5?,9-8-,12-11-/t22-,24-,25+,26-,27+/m1/s1 |
| InChIKey | GONXTWXILMKCCU-JFNJJCAUSA-N |
| XLogP | 4.35 |
| TPSA | 105.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.66 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|