C46H76O9 — CID 10327860
[(2S)-3-[(2R,3R,4S,5S,6R)-6-ethyl-3,4,5-trihydroxyoxan-2-yl]oxy-2-[(9Z,12Z,15Z)-octadeca-9,12,15-trienoyl]oxypropyl] (9Z,12Z,15Z)-octadeca-9,12,15-trienoate (PubChem CID 10327860) has the molecular formula C46H76O9 and a molecular weight of 773.11 g/mol. Its IUPAC name is [(2S)-3-[(2R,3R,4S,5S,6R)-6-ethyl-3,4,5-trihydroxyoxan-2-yl]oxy-2-[(9Z,12Z,15Z)-octadeca-9,12,15-trienoyl]oxypropyl] (9Z,12Z,15Z)-octadeca-9,12,15-trienoate.
| Compound Name | [(2S)-3-[(2R,3R,4S,5S,6R)-6-ethyl-3,4,5-trihydroxyoxan-2-yl]oxy-2-[(9Z,12Z,15Z)-octadeca-9,12,15-trienoyl]oxypropyl] (9Z,12Z,15Z)-octadeca-9,12,15-trienoate |
|---|---|
| PubChem CID | 10327860 |
| Molecular Formula | C46H76O9 |
| Molecular Weight | 773.11 g/mol |
| Exact Mass | 772.55 |
| IUPAC Name | [(2S)-3-[(2R,3R,4S,5S,6R)-6-ethyl-3,4,5-trihydroxyoxan-2-yl]oxy-2-[(9Z,12Z,15Z)-octadeca-9,12,15-trienoyl]oxypropyl] (9Z,12Z,15Z)-octadeca-9,12,15-trienoate |
| SMILES | CC/C=C\C/C=C\C/C=C\CCCCCCCC(=O)OC[C@H](CO[C@@H]1O[C@H](CC)[C@@H](O)[C@H](O)[C@H]1O)OC(=O)CCCCCCC/C=C\C/C=C\C/C=C\CC |
| InChI | InChI=1S/C46H76O9/c1-4-7-9-11-13-15-17-19-21-23-25-27-29-31-33-35-41(47)52-37-39(38-53-46-45(51)44(50)43(49)40(6-3)55-46)54-42(48)36-34-32-30-28-26-24-22-20-18-16-14-12-10-8-5-2/h7-10,13-16,19-22,39-40,43-46,49-51H,4-6,11-12,17-18,23-38H2,1-3H3/b9-7-,10-8-,15-13-,16-14-,21-19-,22-20-/t39-,40-,43-,44+,45-,46-/m1/s1 |
| InChIKey | POUSAGPHCMUIRX-PFQDIYFISA-N |
| XLogP | 9.85 |
| TPSA | 131.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 33 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 773.11 |
| LogP ≤ 5 | 9.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|