C47H78O12S — CID 138243584
[3,4,5-trihydroxy-6-[2-[(11Z,14Z,17Z)-icosa-11,14,17-trienoyl]oxy-3-[(9Z,12Z,15Z)-octadeca-9,12,15-trienoyl]oxypropoxy]oxan-2-yl]methanesulfonic acid (PubChem CID 138243584) has the molecular formula C47H78O12S and a molecular weight of 867.20 g/mol. Its IUPAC name is [3,4,5-trihydroxy-6-[2-[(11Z,14Z,17Z)-icosa-11,14,17-trienoyl]oxy-3-[(9Z,12Z,15Z)-octadeca-9,12,15-trienoyl]oxypropoxy]oxan-2-yl]methanesulfonic acid.
| Compound Name | [3,4,5-trihydroxy-6-[2-[(11Z,14Z,17Z)-icosa-11,14,17-trienoyl]oxy-3-[(9Z,12Z,15Z)-octadeca-9,12,15-trienoyl]oxypropoxy]oxan-2-yl]methanesulfonic acid |
|---|---|
| PubChem CID | 138243584 |
| Molecular Formula | C47H78O12S |
| Molecular Weight | 867.20 g/mol |
| Exact Mass | 866.52 |
| IUPAC Name | [3,4,5-trihydroxy-6-[2-[(11Z,14Z,17Z)-icosa-11,14,17-trienoyl]oxy-3-[(9Z,12Z,15Z)-octadeca-9,12,15-trienoyl]oxypropoxy]oxan-2-yl]methanesulfonic acid |
| SMILES | CC/C=C\C/C=C\C/C=C\CCCCCCCCCC(=O)OC(COC(=O)CCCCCCC/C=C\C/C=C\C/C=C\CC)COC1OC(CS(=O)(=O)O)C(O)C(O)C1O |
| InChI | InChI=1S/C47H78O12S/c1-3-5-7-9-11-13-15-17-19-20-22-24-26-28-30-32-34-36-43(49)58-40(38-57-47-46(52)45(51)44(50)41(59-47)39-60(53,54)55)37-56-42(48)35-33-31-29-27-25-23-21-18-16-14-12-10-8-6-4-2/h5-8,11-14,17-19,21,40-41,44-47,50-52H,3-4,9-10,15-16,20,22-39H2,1-2H3,(H,53,54,55)/b7-5-,8-6-,13-11-,14-12-,19-17-,21-18- |
| InChIKey | QGRYKFYKELNLSH-VBJJEHBKSA-N |
| XLogP | 9.11 |
| TPSA | 186.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 36 |
| Heavy Atoms | 60 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 867.20 |
| LogP ≤ 5 | 9.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|