C33H56O14 — CID 73157033
2,3-bis[[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy]propyl octadeca-9,12,15-trienoate (PubChem CID 73157033) has the molecular formula C33H56O14 and a molecular weight of 676.80 g/mol. Its IUPAC name is 2,3-bis[[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy]propyl octadeca-9,12,15-trienoate.
| Compound Name | 2,3-bis[[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy]propyl octadeca-9,12,15-trienoate |
|---|---|
| PubChem CID | 73157033 |
| Molecular Formula | C33H56O14 |
| Molecular Weight | 676.80 g/mol |
| Exact Mass | 676.37 |
| IUPAC Name | 2,3-bis[[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy]propyl octadeca-9,12,15-trienoate |
| SMILES | CCC=CCC=CCC=CCCCCCCCC(=O)OCC(COC1OC(CO)C(O)C(O)C1O)OC1OC(CO)C(O)C(O)C1O |
| InChI | InChI=1S/C33H56O14/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-25(36)43-20-22(45-33-31(42)29(40)27(38)24(19-35)47-33)21-44-32-30(41)28(39)26(37)23(18-34)46-32/h3-4,6-7,9-10,22-24,26-35,37-42H,2,5,8,11-21H2,1H3 |
| InChIKey | ZUUWWIILVOPVBP-UHFFFAOYSA-N |
| XLogP | 0.12 |
| TPSA | 225.06 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 47 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 676.80 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|