C25H42O9 — CID 125416651
[(2S)-3-hydroxy-2-[(2R,3S,4R,5R,6S)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypropyl] (7Z,10Z,13Z)-hexadeca-7,10,13-trienoate (PubChem CID 125416651) has the molecular formula C25H42O9 and a molecular weight of 486.60 g/mol. Its IUPAC name is [(2S)-3-hydroxy-2-[(2R,3S,4R,5R,6S)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypropyl] (7Z,10Z,13Z)-hexadeca-7,10,13-trienoate.
| Compound Name | [(2S)-3-hydroxy-2-[(2R,3S,4R,5R,6S)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypropyl] (7Z,10Z,13Z)-hexadeca-7,10,13-trienoate |
|---|---|
| PubChem CID | 125416651 |
| Molecular Formula | C25H42O9 |
| Molecular Weight | 486.60 g/mol |
| Exact Mass | 486.28 |
| IUPAC Name | [(2S)-3-hydroxy-2-[(2R,3S,4R,5R,6S)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypropyl] (7Z,10Z,13Z)-hexadeca-7,10,13-trienoate |
| SMILES | CC/C=C\C/C=C\C/C=C\CCCCCC(=O)OC[C@H](CO)O[C@@H]1O[C@@H](CO)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C25H42O9/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-21(28)32-18-19(16-26)33-25-24(31)23(30)22(29)20(17-27)34-25/h3-4,6-7,9-10,19-20,22-27,29-31H,2,5,8,11-18H2,1H3/b4-3-,7-6-,10-9-/t19-,20-,22-,23+,24-,25+/m0/s1 |
| InChIKey | REDDESGUVVWTMB-PIVLJJMJSA-N |
| XLogP | 1.52 |
| TPSA | 145.91 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.60 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|