C28H48O8 — CID 130467958
[2-methyl-3-[(2R,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypropyl] (9Z,12Z,15Z)-octadeca-9,12,15-trienoate (PubChem CID 130467958) has the molecular formula C28H48O8 and a molecular weight of 512.68 g/mol. Its IUPAC name is [2-methyl-3-[(2R,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypropyl] (9Z,12Z,15Z)-octadeca-9,12,15-trienoate.
| Compound Name | [2-methyl-3-[(2R,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypropyl] (9Z,12Z,15Z)-octadeca-9,12,15-trienoate |
|---|---|
| PubChem CID | 130467958 |
| Molecular Formula | C28H48O8 |
| Molecular Weight | 512.68 g/mol |
| Exact Mass | 512.33 |
| IUPAC Name | [2-methyl-3-[(2R,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypropyl] (9Z,12Z,15Z)-octadeca-9,12,15-trienoate |
| SMILES | CC/C=C\C/C=C\C/C=C\CCCCCCCC(=O)OCC(C)CO[C@@H]1O[C@H](CO)[C@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C28H48O8/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-24(30)34-20-22(2)21-35-28-27(33)26(32)25(31)23(19-29)36-28/h4-5,7-8,10-11,22-23,25-29,31-33H,3,6,9,12-21H2,1-2H3/b5-4-,8-7-,11-10-/t22?,23-,25+,26+,27-,28-/m1/s1 |
| InChIKey | OJMCLZFTXUBXRB-PUEKSRTISA-N |
| XLogP | 3.57 |
| TPSA | 125.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.68 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|