C25H42O9 — CID 73046297
[2-hydroxy-3-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypropyl] hexadeca-7,10,13-trienoate (PubChem CID 73046297) has the molecular formula C25H42O9 and a molecular weight of 486.60 g/mol. Its IUPAC name is [2-hydroxy-3-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypropyl] hexadeca-7,10,13-trienoate.
| Compound Name | [2-hydroxy-3-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypropyl] hexadeca-7,10,13-trienoate |
|---|---|
| PubChem CID | 73046297 |
| Molecular Formula | C25H42O9 |
| Molecular Weight | 486.60 g/mol |
| Exact Mass | 486.28 |
| IUPAC Name | [2-hydroxy-3-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypropyl] hexadeca-7,10,13-trienoate |
| SMILES | CCC=CCC=CCC=CCCCCCC(=O)OCC(O)COC1OC(CO)C(O)C(O)C1O |
| InChI | InChI=1S/C25H42O9/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-21(28)32-17-19(27)18-33-25-24(31)23(30)22(29)20(16-26)34-25/h3-4,6-7,9-10,19-20,22-27,29-31H,2,5,8,11-18H2,1H3 |
| InChIKey | PSRSTOVXIJTKGG-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 145.91 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.60 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|