C14H28O4 — CID 159871651
6-(hydroxymethyl)-2,5-bis(2-methylpropyl)oxane-3,4-diol (PubChem CID 159871651) has the molecular formula C14H28O4 and a molecular weight of 260.37 g/mol. Its IUPAC name is 6-(hydroxymethyl)-2,5-bis(2-methylpropyl)oxane-3,4-diol.
| Compound Name | 6-(hydroxymethyl)-2,5-bis(2-methylpropyl)oxane-3,4-diol |
|---|---|
| PubChem CID | 159871651 |
| Molecular Formula | C14H28O4 |
| Molecular Weight | 260.37 g/mol |
| Exact Mass | 260.20 |
| IUPAC Name | 6-(hydroxymethyl)-2,5-bis(2-methylpropyl)oxane-3,4-diol |
| SMILES | CC(C)CC1OC(CO)C(CC(C)C)C(O)C1O |
| InChI | InChI=1S/C14H28O4/c1-8(2)5-10-12(7-15)18-11(6-9(3)4)14(17)13(10)16/h8-17H,5-7H2,1-4H3 |
| InChIKey | AVAJARVHTFEQTI-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.37 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |