C7H14O4 — CID 88976527
(4R,5S)-4,5-bis(hydroxymethyl)-2-methyloxolan-3-ol (PubChem CID 88976527) has the molecular formula C7H14O4 and a molecular weight of 162.18 g/mol. Its IUPAC name is (4R,5S)-4,5-bis(hydroxymethyl)-2-methyloxolan-3-ol.
| Compound Name | (4R,5S)-4,5-bis(hydroxymethyl)-2-methyloxolan-3-ol |
|---|---|
| PubChem CID | 88976527 |
| Molecular Formula | C7H14O4 |
| Molecular Weight | 162.18 g/mol |
| Exact Mass | 162.09 |
| IUPAC Name | (4R,5S)-4,5-bis(hydroxymethyl)-2-methyloxolan-3-ol |
| SMILES | CC1O[C@H](CO)[C@H](CO)C1O |
| InChI | InChI=1S/C7H14O4/c1-4-7(10)5(2-8)6(3-9)11-4/h4-10H,2-3H2,1H3/t4?,5-,6+,7?/m0/s1 |
| InChIKey | YLAPXFODKMMOGB-BJBIKLFWSA-N |
| XLogP | -1.26 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.18 |
| LogP ≤ 5 | -1.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |