C8H16O3S — CID 118011916
(5S)-5-(hydroxymethyl)-2-methyl-4-(2-sulfanylethyl)oxolan-3-ol (PubChem CID 118011916) has the molecular formula C8H16O3S and a molecular weight of 192.28 g/mol. Its IUPAC name is (5S)-5-(hydroxymethyl)-2-methyl-4-(2-sulfanylethyl)oxolan-3-ol.
| Compound Name | (5S)-5-(hydroxymethyl)-2-methyl-4-(2-sulfanylethyl)oxolan-3-ol |
|---|---|
| PubChem CID | 118011916 |
| Molecular Formula | C8H16O3S |
| Molecular Weight | 192.28 g/mol |
| Exact Mass | 192.08 |
| IUPAC Name | (5S)-5-(hydroxymethyl)-2-methyl-4-(2-sulfanylethyl)oxolan-3-ol |
| SMILES | CC1O[C@H](CO)C(CCS)C1O |
| InChI | InChI=1S/C8H16O3S/c1-5-8(10)6(2-3-12)7(4-9)11-5/h5-10,12H,2-4H2,1H3/t5?,6?,7-,8?/m1/s1 |
| InChIKey | SIFBVLUKVSEQSW-DJAIAVIWSA-N |
| XLogP | 0.06 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.28 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|