C14H25O7P — CID 166172125
(2R,3S,4R,5S,6R)-2-(2-diethoxyphosphorylethyl)-6-prop-2-ynyloxane-3,4,5-triol (PubChem CID 166172125) has the molecular formula C14H25O7P and a molecular weight of 336.32 g/mol. Its IUPAC name is (2R,3S,4R,5S,6R)-2-(2-diethoxyphosphorylethyl)-6-prop-2-ynyloxane-3,4,5-triol.
| Compound Name | (2R,3S,4R,5S,6R)-2-(2-diethoxyphosphorylethyl)-6-prop-2-ynyloxane-3,4,5-triol |
|---|---|
| PubChem CID | 166172125 |
| Molecular Formula | C14H25O7P |
| Molecular Weight | 336.32 g/mol |
| Exact Mass | 336.13 |
| IUPAC Name | (2R,3S,4R,5S,6R)-2-(2-diethoxyphosphorylethyl)-6-prop-2-ynyloxane-3,4,5-triol |
| SMILES | C#CC[C@H]1O[C@H](CCP(=O)(OCC)OCC)[C@@H](O)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C14H25O7P/c1-4-7-10-12(15)14(17)13(16)11(21-10)8-9-22(18,19-5-2)20-6-3/h1,10-17H,5-9H2,2-3H3/t10-,11-,12-,13-,14-/m1/s1 |
| InChIKey | DXZROGZYGFAJPQ-DHGKCCLASA-N |
| XLogP | 0.52 |
| TPSA | 105.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.32 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|