C8H17O7P — CID 101233580
[(2R,3S,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]methyl-ethoxyphosphinic acid (PubChem CID 101233580) has the molecular formula C8H17O7P and a molecular weight of 256.19 g/mol. Its IUPAC name is [(2R,3S,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]methyl-ethoxyphosphinic acid.
| Compound Name | [(2R,3S,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]methyl-ethoxyphosphinic acid |
|---|---|
| PubChem CID | 101233580 |
| Molecular Formula | C8H17O7P |
| Molecular Weight | 256.19 g/mol |
| Exact Mass | 256.07 |
| IUPAC Name | [(2R,3S,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]methyl-ethoxyphosphinic acid |
| SMILES | CCOP(=O)(O)C[C@@H]1O[C@H](CO)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C8H17O7P/c1-2-14-16(12,13)4-6-8(11)7(10)5(3-9)15-6/h5-11H,2-4H2,1H3,(H,12,13)/t5-,6+,7-,8-/m1/s1 |
| InChIKey | KEPMJNLETNXSHW-ULAWRXDQSA-N |
| XLogP | -1.31 |
| TPSA | 116.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.19 |
| LogP ≤ 5 | -1.31 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|