C7H15O8P — CID 70363468
2-[(2R,3S,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]ethyl dihydrogen phosphate (PubChem CID 70363468) has the molecular formula C7H15O8P and a molecular weight of 258.16 g/mol. Its IUPAC name is 2-[(2R,3S,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]ethyl dihydrogen phosphate.
| Compound Name | 2-[(2R,3S,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]ethyl dihydrogen phosphate |
|---|---|
| PubChem CID | 70363468 |
| Molecular Formula | C7H15O8P |
| Molecular Weight | 258.16 g/mol |
| Exact Mass | 258.05 |
| IUPAC Name | 2-[(2R,3S,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]ethyl dihydrogen phosphate |
| SMILES | O=P(O)(O)OCC[C@H]1O[C@H](CO)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C7H15O8P/c8-3-5-7(10)6(9)4(15-5)1-2-14-16(11,12)13/h4-10H,1-3H2,(H2,11,12,13)/t4-,5-,6-,7-/m1/s1 |
| InChIKey | FKSCSYLDWOITLN-DBRKOABJSA-N |
| XLogP | -2.03 |
| TPSA | 136.68 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.16 |
| LogP ≤ 5 | -2.03 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|