C6H15O10P — CID 66665794
(2R,3R,4S,5S,6R)-6-(hydroxymethyl)oxane-2,3,4,5-tetrol;phosphoric acid (PubChem CID 66665794) has the molecular formula C6H15O10P and a molecular weight of 278.15 g/mol. Its IUPAC name is (2R,3R,4S,5S,6R)-6-(hydroxymethyl)oxane-2,3,4,5-tetrol;phosphoric acid.
| Compound Name | (2R,3R,4S,5S,6R)-6-(hydroxymethyl)oxane-2,3,4,5-tetrol;phosphoric acid |
|---|---|
| PubChem CID | 66665794 |
| Molecular Formula | C6H15O10P |
| Molecular Weight | 278.15 g/mol |
| Exact Mass | 278.04 |
| IUPAC Name | (2R,3R,4S,5S,6R)-6-(hydroxymethyl)oxane-2,3,4,5-tetrol;phosphoric acid |
| SMILES | O=P(O)(O)O.OC[C@H]1O[C@@H](O)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C6H12O6.H3O4P/c7-1-2-3(8)4(9)5(10)6(11)12-2;1-5(2,3)4/h2-11H,1H2;(H3,1,2,3,4)/t2-,3-,4+,5-,6-;/m1./s1 |
| InChIKey | GZZOCPZTALAJHU-WYRLRVFGSA-N |
| XLogP | -4.15 |
| TPSA | 188.14 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.15 |
| LogP ≤ 5 | -4.15 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|