C7H15O9P — CID 101430180
2-[(2R,3S,4S,5R,6S)-3,4,5,6-tetrahydroxyoxan-2-yl]ethyl dihydrogen phosphate (PubChem CID 101430180) has the molecular formula C7H15O9P and a molecular weight of 274.16 g/mol. Its IUPAC name is 2-[(2R,3S,4S,5R,6S)-3,4,5,6-tetrahydroxyoxan-2-yl]ethyl dihydrogen phosphate.
| Compound Name | 2-[(2R,3S,4S,5R,6S)-3,4,5,6-tetrahydroxyoxan-2-yl]ethyl dihydrogen phosphate |
|---|---|
| PubChem CID | 101430180 |
| Molecular Formula | C7H15O9P |
| Molecular Weight | 274.16 g/mol |
| Exact Mass | 274.05 |
| IUPAC Name | 2-[(2R,3S,4S,5R,6S)-3,4,5,6-tetrahydroxyoxan-2-yl]ethyl dihydrogen phosphate |
| SMILES | O=P(O)(O)OCC[C@H]1O[C@H](O)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C7H15O9P/c8-4-3(1-2-15-17(12,13)14)16-7(11)6(10)5(4)9/h3-11H,1-2H2,(H2,12,13,14)/t3-,4-,5+,6-,7+/m1/s1 |
| InChIKey | AWITVWHYBZFLSC-ZFYZTMLRSA-N |
| XLogP | -2.71 |
| TPSA | 156.91 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.16 |
| LogP ≤ 5 | -2.71 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|