C19H31O11P — CID 166172137
[(2R,3R,4R,5R,6R)-4,5-diacetyloxy-2-(2-diethoxyphosphorylethyl)-6-(2-oxoethyl)oxan-3-yl] acetate (PubChem CID 166172137) has the molecular formula C19H31O11P and a molecular weight of 466.42 g/mol. Its IUPAC name is [(2R,3R,4R,5R,6R)-4,5-diacetyloxy-2-(2-diethoxyphosphorylethyl)-6-(2-oxoethyl)oxan-3-yl] acetate.
| Compound Name | [(2R,3R,4R,5R,6R)-4,5-diacetyloxy-2-(2-diethoxyphosphorylethyl)-6-(2-oxoethyl)oxan-3-yl] acetate |
|---|---|
| PubChem CID | 166172137 |
| Molecular Formula | C19H31O11P |
| Molecular Weight | 466.42 g/mol |
| Exact Mass | 466.16 |
| IUPAC Name | [(2R,3R,4R,5R,6R)-4,5-diacetyloxy-2-(2-diethoxyphosphorylethyl)-6-(2-oxoethyl)oxan-3-yl] acetate |
| SMILES | CCOP(=O)(CC[C@H]1O[C@H](CC=O)[C@@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H]1OC(C)=O)OCC |
| InChI | InChI=1S/C19H31O11P/c1-6-25-31(24,26-7-2)11-9-16-18(28-13(4)22)19(29-14(5)23)17(27-12(3)21)15(30-16)8-10-20/h10,15-19H,6-9,11H2,1-5H3/t15-,16-,17-,18-,19-/m1/s1 |
| InChIKey | PIWSPKARDSZIPQ-FVVUREQNSA-N |
| XLogP | 1.79 |
| TPSA | 140.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.42 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|