C23H34NO12P — CID 166172135
[(2R,3R,4S,5S,6R)-4,5-diacetyloxy-6-(4-amino-3-hydroxyphenoxy)-2-(2-diethoxyphosphorylethyl)oxan-3-yl] acetate (PubChem CID 166172135) has the molecular formula C23H34NO12P and a molecular weight of 547.49 g/mol. Its IUPAC name is [(2R,3R,4S,5S,6R)-4,5-diacetyloxy-6-(4-amino-3-hydroxyphenoxy)-2-(2-diethoxyphosphorylethyl)oxan-3-yl] acetate.
| Compound Name | [(2R,3R,4S,5S,6R)-4,5-diacetyloxy-6-(4-amino-3-hydroxyphenoxy)-2-(2-diethoxyphosphorylethyl)oxan-3-yl] acetate |
|---|---|
| PubChem CID | 166172135 |
| Molecular Formula | C23H34NO12P |
| Molecular Weight | 547.49 g/mol |
| Exact Mass | 547.18 |
| IUPAC Name | [(2R,3R,4S,5S,6R)-4,5-diacetyloxy-6-(4-amino-3-hydroxyphenoxy)-2-(2-diethoxyphosphorylethyl)oxan-3-yl] acetate |
| SMILES | CCOP(=O)(CC[C@H]1O[C@H](Oc2ccc(N)c(O)c2)[C@@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H]1OC(C)=O)OCC |
| InChI | InChI=1S/C23H34NO12P/c1-6-30-37(29,31-7-2)11-10-19-20(32-13(3)25)21(33-14(4)26)22(34-15(5)27)23(36-19)35-16-8-9-17(24)18(28)12-16/h8-9,12,19-23,28H,6-7,10-11,24H2,1-5H3/t19-,20-,21+,22+,23+/m1/s1 |
| InChIKey | ORWDGYFEIKUJDS-VROINQGHSA-N |
| XLogP | 2.53 |
| TPSA | 179.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.49 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|